C29H37N5O6 — CID 10816515
benzyl N-[2-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]ethyl]carbamate (PubChem CID 10816515) has the molecular formula C29H37N5O6 and a molecular weight of 551.64 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 10816515 |
| Molecular Formula | C29H37N5O6 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | benzyl N-[2-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]ethyl]carbamate |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H37N5O6/c1-19(2)14-21(16-26(35)34-39)27(36)33-25(15-22-17-32-24-11-7-6-10-23(22)24)28(37)30-12-13-31-29(38)40-18-20-8-4-3-5-9-20/h3-11,17,19,21,25,32,39H,12-16,18H2,1-2H3,(H,30,37)(H,31,38)(H,33,36)(H,34,35)/t21-,25+/m1/s1 |
| InChIKey | FFEXFXFAIZBMGO-BWKNWUBXSA-N |
| XLogP | 2.80 |
| TPSA | 161.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|