C14H14F13I — CID 10816616
(E)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodotetradec-7-ene (PubChem CID 10816616) has the molecular formula C14H14F13I and a molecular weight of 556.14 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodotetradec-7-ene.
| Compound Name | (E)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodotetradec-7-ene |
|---|---|
| PubChem CID | 10816616 |
| Molecular Formula | C14H14F13I |
| Molecular Weight | 556.14 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | (E)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodotetradec-7-ene |
| SMILES | CCCCCC/C(I)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H14F13I/c1-2-3-4-5-6-8(28)7-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h7H,2-6H2,1H3/b8-7+ |
| InChIKey | PGXQSDHDILHKHE-BQYQJAHWSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.14 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|