C30H25F6N3O2 — CID 10816935
12-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9-(4-methylphenyl)-1,4,12-triazatricyclo[8.7.0.03,8]heptadeca-3(8),4,6,9-tetraene-2,11-dione (PubChem CID 10816935) has the molecular formula C30H25F6N3O2 and a molecular weight of 573.54 g/mol. Its IUPAC name is 12-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9-(4-methylphenyl)-1,4,12-triazatricyclo[8.7.0.03,8]heptadeca-3(8),4,6,9-tetraene-2,11-dione.
| Compound Name | 12-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9-(4-methylphenyl)-1,4,12-triazatricyclo[8.7.0.03,8]heptadeca-3(8),4,6,9-tetraene-2,11-dione |
|---|---|
| PubChem CID | 10816935 |
| Molecular Formula | C30H25F6N3O2 |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 12-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9-(4-methylphenyl)-1,4,12-triazatricyclo[8.7.0.03,8]heptadeca-3(8),4,6,9-tetraene-2,11-dione |
| SMILES | Cc1ccc(-c2c3n(c(=O)c4ncccc24)CCCCCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C3=O)cc1 |
| InChI | InChI=1S/C30H25F6N3O2/c1-18-7-9-20(10-8-18)24-23-6-5-11-37-25(23)27(40)39-13-4-2-3-12-38(28(41)26(24)39)17-19-14-21(29(31,32)33)16-22(15-19)30(34,35)36/h5-11,14-16H,2-4,12-13,17H2,1H3 |
| InChIKey | JVOPERVUZMQBMU-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |