C36H41N5O3 — CID 10817243
1-[1-[2-(1-adamantyl)ethyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-[3-(dimethylamino)phenyl]urea (PubChem CID 10817243) has the molecular formula C36H41N5O3 and a molecular weight of 591.76 g/mol. Its IUPAC name is 1-[1-[2-(1-adamantyl)ethyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-[3-(dimethylamino)phenyl]urea.
| Compound Name | 1-[1-[2-(1-adamantyl)ethyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-[3-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 10817243 |
| Molecular Formula | C36H41N5O3 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | 1-[1-[2-(1-adamantyl)ethyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-[3-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1cccc(NC(=O)NC2C(=O)N(CCC34CC5CC(CC(C5)C3)C4)c3ccccc3N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C36H41N5O3/c1-39(2)29-12-8-9-27(20-29)37-35(44)38-32-33(42)40(16-15-36-21-24-17-25(22-36)19-26(18-24)23-36)30-13-6-7-14-31(30)41(34(32)43)28-10-4-3-5-11-28/h3-14,20,24-26,32H,15-19,21-23H2,1-2H3,(H2,37,38,44) |
| InChIKey | DZGCZNODFMJEHP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|