C24H49BrO6Si3 — CID 10817339
1-[(2S,3S,4R,5S)-3,4-bis(trimethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-bromopropan-2-one (PubChem CID 10817339) has the molecular formula C24H49BrO6Si3 and a molecular weight of 597.81 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5S)-3,4-bis(trimethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-bromopropan-2-one.
| Compound Name | 1-[(2S,3S,4R,5S)-3,4-bis(trimethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-bromopropan-2-one |
|---|---|
| PubChem CID | 10817339 |
| Molecular Formula | C24H49BrO6Si3 |
| Molecular Weight | 597.81 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | 1-[(2S,3S,4R,5S)-3,4-bis(trimethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-bromopropan-2-one |
| SMILES | C[C@H]([C@@H]1O[C@H]1C[C@H]1CO[C@@H](CC(=O)CBr)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[C@H](C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H49BrO6Si3/c1-16(17(2)29-32(3,4)5)22-21(28-22)12-18-15-27-20(13-19(26)14-25)24(31-34(9,10)11)23(18)30-33(6,7)8/h16-18,20-24H,12-15H2,1-11H3/t16-,17-,18-,20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | XNSPVBJCTNEPST-ZCDCILQWSA-N |
| XLogP | 5.83 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.81 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|