C35H31N5O5 — CID 10817407
N-(1,3-benzodioxol-5-yl)-2-[3-(2H-indazol-3-ylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-propan-2-ylacetamide (PubChem CID 10817407) has the molecular formula C35H31N5O5 and a molecular weight of 601.66 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[3-(2H-indazol-3-ylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[3-(2H-indazol-3-ylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 10817407 |
| Molecular Formula | C35H31N5O5 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[3-(2H-indazol-3-ylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C(=O)CN1C(=O)C(Cc2[nH]nc3ccccc23)C(=O)N(c2ccccc2)c2ccccc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H31N5O5/c1-22(2)39(24-16-17-31-32(18-24)45-21-44-31)33(41)20-38-29-14-8-9-15-30(29)40(23-10-4-3-5-11-23)35(43)26(34(38)42)19-28-25-12-6-7-13-27(25)36-37-28/h3-18,22,26H,19-21H2,1-2H3,(H,36,37) |
| InChIKey | HQDSSVWRHVHJGQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|