C10H6Cl2F9N3O6S3 — CID 10817418
4,5-dichloro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzene-1,3-disulfonamide (PubChem CID 10817418) has the molecular formula C10H6Cl2F9N3O6S3 and a molecular weight of 602.26 g/mol. Its IUPAC name is 4,5-dichloro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzene-1,3-disulfonamide.
| Compound Name | 4,5-dichloro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 10817418 |
| Molecular Formula | C10H6Cl2F9N3O6S3 |
| Molecular Weight | 602.26 g/mol |
| Exact Mass | 600.87 |
| IUPAC Name | 4,5-dichloro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cc(S(N)(=O)=O)c(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C10H6Cl2F9N3O6S3/c11-4-2(31(22,25)26)1-3(32(23,27)28)6(5(4)12)24-33(29,30)10(20,21)8(15,16)7(13,14)9(17,18)19/h1,24H,(H2,22,25,26)(H2,23,27,28) |
| InChIKey | RDZMYHLZUARPKF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 166.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|