C16H8F17NO4S — CID 10817828
(4-sulfamoylphenyl)methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate (PubChem CID 10817828) has the molecular formula C16H8F17NO4S and a molecular weight of 633.28 g/mol. Its IUPAC name is (4-sulfamoylphenyl)methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate.
| Compound Name | (4-sulfamoylphenyl)methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
|---|---|
| PubChem CID | 10817828 |
| Molecular Formula | C16H8F17NO4S |
| Molecular Weight | 633.28 g/mol |
| Exact Mass | 632.99 |
| IUPAC Name | (4-sulfamoylphenyl)methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
| SMILES | NS(=O)(=O)c1ccc(COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H8F17NO4S/c17-9(18,8(35)38-5-6-1-3-7(4-2-6)39(34,36)37)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h1-4H,5H2,(H2,34,36,37) |
| InChIKey | FGDACTBUXYCUEM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.28 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|