C31H49N7O8 — CID 10817975
(2S,5S)-5-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-carboxypropanoyl]amino]-2-benzyl-6-methyl-4-oxoheptanoic acid (PubChem CID 10817975) has the molecular formula C31H49N7O8 and a molecular weight of 647.77 g/mol. Its IUPAC name is (2S,5S)-5-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-carboxypropanoyl]amino]-2-benzyl-6-methyl-4-oxoheptanoic acid.
| Compound Name | (2S,5S)-5-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-carboxypropanoyl]amino]-2-benzyl-6-methyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 10817975 |
| Molecular Formula | C31H49N7O8 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.36 |
| IUPAC Name | (2S,5S)-5-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-carboxypropanoyl]amino]-2-benzyl-6-methyl-4-oxoheptanoic acid |
| SMILES | CCCC[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)C[C@H](Cc1ccccc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C31H49N7O8/c1-4-5-13-22(36-27(42)21(32)12-9-14-35-31(33)34)28(43)37-23(17-25(40)41)29(44)38-26(18(2)3)24(39)16-20(30(45)46)15-19-10-7-6-8-11-19/h6-8,10-11,18,20-23,26H,4-5,9,12-17,32H2,1-3H3,(H,36,42)(H,37,43)(H,38,44)(H,40,41)(H,45,46)(H4,33,34,35)/t20-,21-,22-,23-,26-/m0/s1 |
| InChIKey | YIBIHXPXOGRUPY-KQWWLPFYSA-N |
| XLogP | 0.05 |
| TPSA | 269.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|