C34H30N4O+2 — CID 10818198
17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaen-38-ol (PubChem CID 10818198) has the molecular formula C34H30N4O+2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaen-38-ol.
| Compound Name | 17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaen-38-ol |
|---|---|
| PubChem CID | 10818198 |
| Molecular Formula | C34H30N4O+2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaen-38-ol |
| SMILES | Oc1c2cccc1C[n+]1ccc(c3ccccc31)NCc1ccc(cc1)CNc1cc[n+](c3ccccc13)C2 |
| InChI | InChI=1S/C34H28N4O/c39-34-26-6-5-7-27(34)23-38-19-17-31(29-9-2-4-11-33(29)38)36-21-25-14-12-24(13-15-25)20-35-30-16-18-37(22-26)32-10-3-1-8-28(30)32/h1-19,39H,20-23H2/p+2/b35-30+,36-31+ |
| InChIKey | AXGSAMYCJXCNFL-NMGZYESXSA-P |
| XLogP | 5.91 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|