C36H60O12 — CID 10818360
(12,20-diacetyloxy-3,5,8,11,13,16,19,21,24-nonamethyl-2,10,18-trioxo-1,9,17-trioxacyclotetracos-4-yl) acetate (PubChem CID 10818360) has the molecular formula C36H60O12 and a molecular weight of 684.86 g/mol. Its IUPAC name is (12,20-diacetyloxy-3,5,8,11,13,16,19,21,24-nonamethyl-2,10,18-trioxo-1,9,17-trioxacyclotetracos-4-yl) acetate.
| Compound Name | (12,20-diacetyloxy-3,5,8,11,13,16,19,21,24-nonamethyl-2,10,18-trioxo-1,9,17-trioxacyclotetracos-4-yl) acetate |
|---|---|
| PubChem CID | 10818360 |
| Molecular Formula | C36H60O12 |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.41 |
| IUPAC Name | (12,20-diacetyloxy-3,5,8,11,13,16,19,21,24-nonamethyl-2,10,18-trioxo-1,9,17-trioxacyclotetracos-4-yl) acetate |
| SMILES | CC(=O)OC1C(C)CCC(C)OC(=O)C(C)C(OC(C)=O)C(C)CCC(C)OC(=O)C(C)C(OC(C)=O)C(C)CCC(C)OC(=O)C1C |
| InChI | InChI=1S/C36H60O12/c1-19-13-16-22(4)43-35(41)26(8)32(47-29(11)38)21(3)15-18-24(6)45-36(42)27(9)33(48-30(12)39)20(2)14-17-23(5)44-34(40)25(7)31(19)46-28(10)37/h19-27,31-33H,13-18H2,1-12H3 |
| InChIKey | IJHPUSZYBISZPC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|