C37H35IN2O2Si — CID 10818442
[5-[[5-(4-iodobenzoyl)-1H-pyrrol-2-yl]-(2,4,6-trimethylphenyl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanone (PubChem CID 10818442) has the molecular formula C37H35IN2O2Si and a molecular weight of 694.69 g/mol. Its IUPAC name is [5-[[5-(4-iodobenzoyl)-1H-pyrrol-2-yl]-(2,4,6-trimethylphenyl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanone.
| Compound Name | [5-[[5-(4-iodobenzoyl)-1H-pyrrol-2-yl]-(2,4,6-trimethylphenyl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 10818442 |
| Molecular Formula | C37H35IN2O2Si |
| Molecular Weight | 694.69 g/mol |
| Exact Mass | 694.15 |
| IUPAC Name | [5-[[5-(4-iodobenzoyl)-1H-pyrrol-2-yl]-(2,4,6-trimethylphenyl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanone |
| SMILES | Cc1cc(C)c(C(c2ccc(C(=O)c3ccc(I)cc3)[nH]2)c2ccc(C(=O)c3ccc(C#C[Si](C)(C)C)cc3)[nH]2)c(C)c1 |
| InChI | InChI=1S/C37H35IN2O2Si/c1-23-21-24(2)34(25(3)22-23)35(31-16-18-33(40-31)37(42)28-11-13-29(38)14-12-28)30-15-17-32(39-30)36(41)27-9-7-26(8-10-27)19-20-43(4,5)6/h7-18,21-22,35,39-40H,1-6H3 |
| InChIKey | SASLKYLBGMAEPC-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.69 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|