C39H41N3O7S — CID 10818452
(4-nitrophenyl)methyl (2S,4S)-2-[(1R)-1-hydroxy-3-[methyl(prop-2-enoxycarbonyl)amino]propyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 10818452) has the molecular formula C39H41N3O7S and a molecular weight of 695.84 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[(1R)-1-hydroxy-3-[methyl(prop-2-enoxycarbonyl)amino]propyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[(1R)-1-hydroxy-3-[methyl(prop-2-enoxycarbonyl)amino]propyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10818452 |
| Molecular Formula | C39H41N3O7S |
| Molecular Weight | 695.84 g/mol |
| Exact Mass | 695.27 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[(1R)-1-hydroxy-3-[methyl(prop-2-enoxycarbonyl)amino]propyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N(C)CC[C@@H](O)[C@@H]1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C39H41N3O7S/c1-3-25-48-37(44)40(2)24-23-36(43)35-26-34(27-41(35)38(45)49-28-29-19-21-33(22-20-29)42(46)47)50-39(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h3-22,34-36,43H,1,23-28H2,2H3/t34-,35-,36+/m0/s1 |
| InChIKey | FXEIHFAEINPWME-QGBCWPEESA-N |
| XLogP | 7.41 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.84 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|