C21H26F17N2O4P — CID 10818657
4-[6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecoxy(morpholin-4-yl)phosphoryl]morpholine (PubChem CID 10818657) has the molecular formula C21H26F17N2O4P and a molecular weight of 724.39 g/mol. Its IUPAC name is 4-[6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecoxy(morpholin-4-yl)phosphoryl]morpholine.
| Compound Name | 4-[6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecoxy(morpholin-4-yl)phosphoryl]morpholine |
|---|---|
| PubChem CID | 10818657 |
| Molecular Formula | C21H26F17N2O4P |
| Molecular Weight | 724.39 g/mol |
| Exact Mass | 724.14 |
| IUPAC Name | 4-[6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecoxy(morpholin-4-yl)phosphoryl]morpholine |
| SMILES | O=P(OCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C21H26F17N2O4P/c22-14(23,4-2-1-3-9-44-45(41,39-5-10-42-11-6-39)40-7-12-43-13-8-40)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)38/h1-13H2 |
| InChIKey | WXUZPIXZRQXBBV-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.39 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|