About (3R)-3-hydroxy-2,3-dihydroinden-1-one
(3R)-3-hydroxy-2,3-dihydroinden-1-one (PubChem CID 10820702) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is (3R)-3-hydroxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-2,3-dihydroinden-1-one |
| PubChem CID | 10820702 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | (3R)-3-hydroxy-2,3-dihydroinden-1-one |
| SMILES | O=C1C[C@@H](O)c2ccccc21 |
| InChI | InChI=1S/C9H8O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4,8,10H,5H2/t8-/m1/s1 |
| InChIKey | UOBZGMJWBBQSLX-MRVPVSSYSA-N |
| XLogP | 1.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-hydroxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-2,3-dihydroinden-1-one?
The IUPAC name of (3R)-3-hydroxy-2,3-dihydroinden-1-one (CID 10820702) is (3R)-3-hydroxy-2,3-dihydroinden-1-one.
What is the SMILES notation for (3R)-3-hydroxy-2,3-dihydroinden-1-one?
The canonical SMILES for (3R)-3-hydroxy-2,3-dihydroinden-1-one is O=C1C[C@@H](O)c2ccccc21.
What is the InChIKey of (3R)-3-hydroxy-2,3-dihydroinden-1-one?
The InChIKey is UOBZGMJWBBQSLX-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H8O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4,8,10H,5H2/t8-/m1/s1.
What are the key properties of (3R)-3-hydroxy-2,3-dihydroinden-1-one?
(3R)-3-hydroxy-2,3-dihydroinden-1-one has a molecular weight of 148.16 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 10820702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).