C8H10O3 — CID 10820771
3-methyl-4-propan-2-yloxycyclobut-3-ene-1,2-dione (PubChem CID 10820771) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 3-methyl-4-propan-2-yloxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-methyl-4-propan-2-yloxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 10820771 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3-methyl-4-propan-2-yloxycyclobut-3-ene-1,2-dione |
| SMILES | Cc1c(OC(C)C)c(=O)c1=O |
| InChI | InChI=1S/C8H10O3/c1-4(2)11-8-5(3)6(9)7(8)10/h4H,1-3H3 |
| InChIKey | OZOYNWQSFNTBNE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|