About methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate
methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate (PubChem CID 10820815) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate.
Molecular Properties
| Compound Name | methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate |
| PubChem CID | 10820815 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)[C@H]1C=CC[C@H](C)O1 |
| InChI | InChI=1S/C8H12O3/c1-6-4-3-5-7(11-6)8(9)10-2/h3,5-7H,4H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | JJPDBYYISDTBEA-NKWVEPMBSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate?
The IUPAC name of methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate (CID 10820815) is methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate.
What is the SMILES notation for methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate?
The canonical SMILES for methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate is COC(=O)[C@H]1C=CC[C@H](C)O1.
What is the InChIKey of methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate?
The InChIKey is JJPDBYYISDTBEA-NKWVEPMBSA-N. The full InChI is InChI=1S/C8H12O3/c1-6-4-3-5-7(11-6)8(9)10-2/h3,5-7H,4H2,1-2H3/t6-,7+/m0/s1.
What are the key properties of methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate?
methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate has a molecular weight of 156.18 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,6R)-2-methyl-3,6-dihydro-2H-pyran-6-carboxylate is sourced from PubChem (CID 10820815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).