About (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one
(4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one (PubChem CID 10820845) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one.
Molecular Properties
| Compound Name | (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one |
| PubChem CID | 10820845 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one |
| SMILES | CCC(=O)[C@H](C)[C@H](O)C(C)C |
| InChI | InChI=1S/C9H18O2/c1-5-8(10)7(4)9(11)6(2)3/h6-7,9,11H,5H2,1-4H3/t7-,9+/m0/s1 |
| InChIKey | BIEQEQORPVLGMS-IONNQARKSA-N |
| XLogP | 1.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one?
The IUPAC name of (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one (CID 10820845) is (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one.
What is the SMILES notation for (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one?
The canonical SMILES for (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one is CCC(=O)[C@H](C)[C@H](O)C(C)C.
What is the InChIKey of (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one?
The InChIKey is BIEQEQORPVLGMS-IONNQARKSA-N. The full InChI is InChI=1S/C9H18O2/c1-5-8(10)7(4)9(11)6(2)3/h6-7,9,11H,5H2,1-4H3/t7-,9+/m0/s1.
What are the key properties of (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one?
(4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one has a molecular weight of 158.24 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-5-hydroxy-4,6-dimethylheptan-3-one is sourced from PubChem (CID 10820845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).