About N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide
N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide (PubChem CID 10820850) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide |
| PubChem CID | 10820850 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/CCCCCO |
| InChI | InChI=1S/C8H18N2O/c1-10(2)8-9-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3/b9-8+ |
| InChIKey | GRPVPZZOJGJDDN-CMDGGOBGSA-N |
| XLogP | 0.74 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide?
The IUPAC name of N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide (CID 10820850) is N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide is CN(C)/C=N/CCCCCO.
What is the InChIKey of N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide?
The InChIKey is GRPVPZZOJGJDDN-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H18N2O/c1-10(2)8-9-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3/b9-8+.
What are the key properties of N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide?
N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide has a molecular weight of 158.25 g/mol, XLogP of 0.74, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-hydroxypentyl)-N,N-dimethylmethanimidamide is sourced from PubChem (CID 10820850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).