About 5,8-dihydropteridine-6,7-dione
5,8-dihydropteridine-6,7-dione (PubChem CID 10820906) has the molecular formula C6H4N4O2
and a molecular weight of 164.12 g/mol. Its IUPAC name is 5,8-dihydropteridine-6,7-dione.
Molecular Properties
| Compound Name | 5,8-dihydropteridine-6,7-dione |
| PubChem CID | 10820906 |
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 5,8-dihydropteridine-6,7-dione |
| SMILES | O=c1[nH]c2cncnc2[nH]c1=O |
| InChI | InChI=1S/C6H4N4O2/c11-5-6(12)10-4-3(9-5)1-7-2-8-4/h1-2H,(H,9,11)(H,7,8,10,12) |
| InChIKey | HNSVDKLARSSFGE-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dihydropteridine-6,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dihydropteridine-6,7-dione?
The IUPAC name of 5,8-dihydropteridine-6,7-dione (CID 10820906) is 5,8-dihydropteridine-6,7-dione.
What is the SMILES notation for 5,8-dihydropteridine-6,7-dione?
The canonical SMILES for 5,8-dihydropteridine-6,7-dione is O=c1[nH]c2cncnc2[nH]c1=O.
What is the InChIKey of 5,8-dihydropteridine-6,7-dione?
The InChIKey is HNSVDKLARSSFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2/c11-5-6(12)10-4-3(9-5)1-7-2-8-4/h1-2H,(H,9,11)(H,7,8,10,12).
What are the key properties of 5,8-dihydropteridine-6,7-dione?
5,8-dihydropteridine-6,7-dione has a molecular weight of 164.12 g/mol, XLogP of -0.99, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dihydropteridine-6,7-dione is sourced from PubChem (CID 10820906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).