About 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine
3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine (PubChem CID 10820959) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine.
Analyze 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine?
The IUPAC name of 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine (CID 10820959) is 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine.
What is the SMILES notation for 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine?
The canonical SMILES for 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine is CN(C)c1cnnc(N(C)C)c1.
What is the InChIKey of 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine?
The InChIKey is JXPVDAFEIHVOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-11(2)7-5-8(12(3)4)10-9-6-7/h5-6H,1-4H3.
What are the key properties of 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine?
3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine has a molecular weight of 166.23 g/mol, XLogP of 0.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N,5-N,5-N-tetramethylpyridazine-3,5-diamine is sourced from PubChem (CID 10820959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).