About 3-methylimidazo[2,1-f]purine
3-methylimidazo[2,1-f]purine (PubChem CID 10821088) has the molecular formula C8H7N5
and a molecular weight of 173.18 g/mol. Its IUPAC name is 3-methylimidazo[2,1-f]purine.
Molecular Properties
| Compound Name | 3-methylimidazo[2,1-f]purine |
| PubChem CID | 10821088 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-methylimidazo[2,1-f]purine |
| SMILES | Cn1cnc2c1ncn1ccnc21 |
| InChI | InChI=1S/C8H7N5/c1-12-4-10-6-7(12)11-5-13-3-2-9-8(6)13/h2-5H,1H3 |
| InChIKey | OMPOPGSMAWCHBX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methylimidazo[2,1-f]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylimidazo[2,1-f]purine?
The IUPAC name of 3-methylimidazo[2,1-f]purine (CID 10821088) is 3-methylimidazo[2,1-f]purine.
What is the SMILES notation for 3-methylimidazo[2,1-f]purine?
The canonical SMILES for 3-methylimidazo[2,1-f]purine is Cn1cnc2c1ncn1ccnc21.
What is the InChIKey of 3-methylimidazo[2,1-f]purine?
The InChIKey is OMPOPGSMAWCHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5/c1-12-4-10-6-7(12)11-5-13-3-2-9-8(6)13/h2-5H,1H3.
What are the key properties of 3-methylimidazo[2,1-f]purine?
3-methylimidazo[2,1-f]purine has a molecular weight of 173.18 g/mol, XLogP of 0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylimidazo[2,1-f]purine is sourced from PubChem (CID 10821088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).