About 2-ethenyladamantan-2-ol
2-ethenyladamantan-2-ol (PubChem CID 10821208) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 2-ethenyladamantan-2-ol.
Molecular Properties
| Compound Name | 2-ethenyladamantan-2-ol |
| PubChem CID | 10821208 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2-ethenyladamantan-2-ol |
| SMILES | C=CC1(O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C12H18O/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8/h2,8-11,13H,1,3-7H2 |
| InChIKey | UIZDKBJUQISNGN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyladamantan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyladamantan-2-ol?
The IUPAC name of 2-ethenyladamantan-2-ol (CID 10821208) is 2-ethenyladamantan-2-ol.
What is the SMILES notation for 2-ethenyladamantan-2-ol?
The canonical SMILES for 2-ethenyladamantan-2-ol is C=CC1(O)C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-ethenyladamantan-2-ol?
The InChIKey is UIZDKBJUQISNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8/h2,8-11,13H,1,3-7H2.
What are the key properties of 2-ethenyladamantan-2-ol?
2-ethenyladamantan-2-ol has a molecular weight of 178.27 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyladamantan-2-ol is sourced from PubChem (CID 10821208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).