C12H14N2 — CID 10821415
1,3-dimethyl-6,7-dihydro-5H-pyrrolo[2,3-f]indole (PubChem CID 10821415) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1,3-dimethyl-6,7-dihydro-5H-pyrrolo[2,3-f]indole.
| Compound Name | 1,3-dimethyl-6,7-dihydro-5H-pyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 10821415 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1,3-dimethyl-6,7-dihydro-5H-pyrrolo[2,3-f]indole |
| SMILES | Cc1cn(C)c2cc3c(cc12)NCC3 |
| InChI | InChI=1S/C12H14N2/c1-8-7-14(2)12-5-9-3-4-13-11(9)6-10(8)12/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | FKTCCMLMYHUHNJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|