C4H11ClN2O2S — CID 10821425
[(E,2S)-4-sulfamoylbut-3-en-2-yl]azanium chloride (PubChem CID 10821425) has the molecular formula C4H11ClN2O2S and a molecular weight of 186.66 g/mol. Its IUPAC name is [(E,2S)-4-sulfamoylbut-3-en-2-yl]azanium chloride.
| Compound Name | [(E,2S)-4-sulfamoylbut-3-en-2-yl]azanium chloride |
|---|---|
| PubChem CID | 10821425 |
| Molecular Formula | C4H11ClN2O2S |
| Molecular Weight | 186.66 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | [(E,2S)-4-sulfamoylbut-3-en-2-yl]azanium chloride |
| SMILES | C[C@H]([NH3+])/C=C/S(N)(=O)=O.[Cl-] |
| InChI | InChI=1S/C4H10N2O2S.ClH/c1-4(5)2-3-9(6,7)8;/h2-4H,5H2,1H3,(H2,6,7,8);1H/b3-2+;/t4-;/m0./s1 |
| InChIKey | GNAHIGPJRLXKKZ-XMFKBHDTSA-N |
| XLogP | -4.58 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.66 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |