About N'-quinolin-4-ylethane-1,2-diamine
N'-quinolin-4-ylethane-1,2-diamine (PubChem CID 10821443) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is N'-quinolin-4-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-quinolin-4-ylethane-1,2-diamine |
| PubChem CID | 10821443 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N'-quinolin-4-ylethane-1,2-diamine |
| SMILES | NCCNc1ccnc2ccccc12 |
| InChI | InChI=1S/C11H13N3/c12-6-8-14-11-5-7-13-10-4-2-1-3-9(10)11/h1-5,7H,6,8,12H2,(H,13,14) |
| InChIKey | VFWKJZJCYMNIRF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-quinolin-4-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-quinolin-4-ylethane-1,2-diamine?
The IUPAC name of N'-quinolin-4-ylethane-1,2-diamine (CID 10821443) is N'-quinolin-4-ylethane-1,2-diamine.
What is the SMILES notation for N'-quinolin-4-ylethane-1,2-diamine?
The canonical SMILES for N'-quinolin-4-ylethane-1,2-diamine is NCCNc1ccnc2ccccc12.
What is the InChIKey of N'-quinolin-4-ylethane-1,2-diamine?
The InChIKey is VFWKJZJCYMNIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c12-6-8-14-11-5-7-13-10-4-2-1-3-9(10)11/h1-5,7H,6,8,12H2,(H,13,14).
What are the key properties of N'-quinolin-4-ylethane-1,2-diamine?
N'-quinolin-4-ylethane-1,2-diamine has a molecular weight of 187.25 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-quinolin-4-ylethane-1,2-diamine is sourced from PubChem (CID 10821443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).