C10H13NO3 — CID 10821675
1-[(E)-hex-2-enoyl]pyrrolidine-2,5-dione (PubChem CID 10821675) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-[(E)-hex-2-enoyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(E)-hex-2-enoyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10821675 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-[(E)-hex-2-enoyl]pyrrolidine-2,5-dione |
| SMILES | CCC/C=C/C(=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C10H13NO3/c1-2-3-4-5-8(12)11-9(13)6-7-10(11)14/h4-5H,2-3,6-7H2,1H3/b5-4+ |
| InChIKey | KRBHJKSJJZERGV-SNAWJCMRSA-N |
| XLogP | 1.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|