About trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate
trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate (PubChem CID 10821808) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate |
| PubChem CID | 10821808 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate |
| SMILES | C=CCC[C@@]1(C(=O)OC)CCC[C@H]1O |
| InChI | InChI=1S/C11H18O3/c1-3-4-7-11(10(13)14-2)8-5-6-9(11)12/h3,9,12H,1,4-8H2,2H3/t9-,11-/m1/s1 |
| InChIKey | USNGRXBXQGCNMP-MWLCHTKSSA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate?
The IUPAC name of trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate (CID 10821808) is trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate.
What is the SMILES notation for trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate?
The canonical SMILES for trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate is C=CCC[C@@]1(C(=O)OC)CCC[C@H]1O.
What is the InChIKey of trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate?
The InChIKey is USNGRXBXQGCNMP-MWLCHTKSSA-N. The full InChI is InChI=1S/C11H18O3/c1-3-4-7-11(10(13)14-2)8-5-6-9(11)12/h3,9,12H,1,4-8H2,2H3/t9-,11-/m1/s1.
What are the key properties of trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate?
trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate has a molecular weight of 198.26 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1S,2R)-1-but-3-enyl-2-hydroxycyclopentane-1-carboxylate is sourced from PubChem (CID 10821808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).