C7H3Cl2N3 — CID 10821876
4,6-dichloropyrido[3,4-d]pyrimidine (PubChem CID 10821876) has the molecular formula C7H3Cl2N3 and a molecular weight of 200.03 g/mol. Its IUPAC name is 4,6-dichloropyrido[3,4-d]pyrimidine.
| Compound Name | 4,6-dichloropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 10821876 |
| Molecular Formula | C7H3Cl2N3 |
| Molecular Weight | 200.03 g/mol |
| Exact Mass | 198.97 |
| IUPAC Name | 4,6-dichloropyrido[3,4-d]pyrimidine |
| SMILES | Clc1cc2c(Cl)ncnc2cn1 |
| InChI | InChI=1S/C7H3Cl2N3/c8-6-1-4-5(2-10-6)11-3-12-7(4)9/h1-3H |
| InChIKey | CKPNVNAKQGYUSK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.03 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|