About 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one
9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one (PubChem CID 10821901) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one.
Molecular Properties
| Compound Name | 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one |
| PubChem CID | 10821901 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one |
| SMILES | NC1CCC(=O)n2c1cc1ccccc12 |
| InChI | InChI=1S/C12H12N2O/c13-9-5-6-12(15)14-10-4-2-1-3-8(10)7-11(9)14/h1-4,7,9H,5-6,13H2 |
| InChIKey | VMKAXSVOYXMWSS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one?
The IUPAC name of 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one (CID 10821901) is 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one.
What is the SMILES notation for 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one?
The canonical SMILES for 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one is NC1CCC(=O)n2c1cc1ccccc12.
What is the InChIKey of 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one?
The InChIKey is VMKAXSVOYXMWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c13-9-5-6-12(15)14-10-4-2-1-3-8(10)7-11(9)14/h1-4,7,9H,5-6,13H2.
What are the key properties of 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one?
9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one has a molecular weight of 200.24 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one is sourced from PubChem (CID 10821901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).