About 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one
4-anilino-2,5-dimethyl-1,2,4-triazol-3-one (PubChem CID 10822056) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one |
| PubChem CID | 10822056 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one |
| SMILES | Cc1nn(C)c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C10H12N4O/c1-8-11-13(2)10(15)14(8)12-9-6-4-3-5-7-9/h3-7,12H,1-2H3 |
| InChIKey | OGVRWFLAAJLUNT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one?
The IUPAC name of 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one (CID 10822056) is 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one.
What is the SMILES notation for 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one?
The canonical SMILES for 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one is Cc1nn(C)c(=O)n1Nc1ccccc1.
What is the InChIKey of 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one?
The InChIKey is OGVRWFLAAJLUNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-8-11-13(2)10(15)14(8)12-9-6-4-3-5-7-9/h3-7,12H,1-2H3.
What are the key properties of 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one?
4-anilino-2,5-dimethyl-1,2,4-triazol-3-one has a molecular weight of 204.23 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-2,5-dimethyl-1,2,4-triazol-3-one is sourced from PubChem (CID 10822056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).