C12H14O3 — CID 10822148
(1S,2R,3R,6R,8S,9R)-4,14-dioxatetracyclo[7.2.2.13,6.02,8]tetradec-10-en-7-one (PubChem CID 10822148) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1S,2R,3R,6R,8S,9R)-4,14-dioxatetracyclo[7.2.2.13,6.02,8]tetradec-10-en-7-one.
| Compound Name | (1S,2R,3R,6R,8S,9R)-4,14-dioxatetracyclo[7.2.2.13,6.02,8]tetradec-10-en-7-one |
|---|---|
| PubChem CID | 10822148 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1S,2R,3R,6R,8S,9R)-4,14-dioxatetracyclo[7.2.2.13,6.02,8]tetradec-10-en-7-one |
| SMILES | O=C1[C@@H]2[C@H]([C@@H]3OC[C@H]1O3)[C@@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C12H14O3/c13-11-8-5-14-12(15-8)10-7-3-1-6(2-4-7)9(10)11/h1,3,6-10,12H,2,4-5H2/t6-,7+,8+,9-,10+,12+/m0/s1 |
| InChIKey | LCEYKRHKGUWLTJ-VCXOXUAUSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|