C12H16O3 — CID 10822251
(1S,2S,5R,8R)-2-methoxytricyclo[6.3.0.01,5]undecane-3,7-dione (PubChem CID 10822251) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1S,2S,5R,8R)-2-methoxytricyclo[6.3.0.01,5]undecane-3,7-dione.
| Compound Name | (1S,2S,5R,8R)-2-methoxytricyclo[6.3.0.01,5]undecane-3,7-dione |
|---|---|
| PubChem CID | 10822251 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (1S,2S,5R,8R)-2-methoxytricyclo[6.3.0.01,5]undecane-3,7-dione |
| SMILES | CO[C@@H]1C(=O)C[C@H]2CC(=O)[C@@H]3CCC[C@@]213 |
| InChI | InChI=1S/C12H16O3/c1-15-11-10(14)6-7-5-9(13)8-3-2-4-12(7,8)11/h7-8,11H,2-6H2,1H3/t7-,8+,11-,12+/m1/s1 |
| InChIKey | UZSZLCPDXRZPGG-FCMYFTRRSA-N |
| XLogP | 1.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |