methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate

C8H13F2NO3 — CID 10822287

IUPACmethyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate
SMILESCOC(=O)CCC(F)(F)C(=O)N(C)C
InChIInChI=1S/C8H13F2NO3/c1-11(2)7(13)8(9,10)5-4-6(12)14-3/h4-5H2,1-3H3
InChIKeyJYJVKRHDWXKZCH-UHFFFAOYSA-N
MW209.19 g/mol
LogP0.66
Rot. Bonds4

About methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate

methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate (PubChem CID 10822287) has the molecular formula C8H13F2NO3 and a molecular weight of 209.19 g/mol. Its IUPAC name is methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate.

Molecular Properties

Compound Namemethyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate
PubChem CID10822287
Molecular FormulaC8H13F2NO3
Molecular Weight209.19 g/mol
Exact Mass209.09
IUPAC Namemethyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate
SMILESCOC(=O)CCC(F)(F)C(=O)N(C)C
InChIInChI=1S/C8H13F2NO3/c1-11(2)7(13)8(9,10)5-4-6(12)14-3/h4-5H2,1-3H3
InChIKeyJYJVKRHDWXKZCH-UHFFFAOYSA-N
XLogP0.66
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.19
LogP ≤ 50.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate?
The IUPAC name of methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate (CID 10822287) is methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate.
What is the SMILES notation for methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate?
The canonical SMILES for methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate is COC(=O)CCC(F)(F)C(=O)N(C)C.
What is the InChIKey of methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate?
The InChIKey is JYJVKRHDWXKZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO3/c1-11(2)7(13)8(9,10)5-4-6(12)14-3/h4-5H2,1-3H3.
What are the key properties of methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate?
methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate has a molecular weight of 209.19 g/mol, XLogP of 0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(dimethylamino)-4,4-difluoro-5-oxopentanoate is sourced from PubChem (CID 10822287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).