C12H19NO2 — CID 10822305
(3S,8aS)-3-(hydroxymethyl)-2,8a-dimethyl-4,6,7,8-tetrahydro-3H-isoquinolin-1-one (PubChem CID 10822305) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (3S,8aS)-3-(hydroxymethyl)-2,8a-dimethyl-4,6,7,8-tetrahydro-3H-isoquinolin-1-one.
| Compound Name | (3S,8aS)-3-(hydroxymethyl)-2,8a-dimethyl-4,6,7,8-tetrahydro-3H-isoquinolin-1-one |
|---|---|
| PubChem CID | 10822305 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (3S,8aS)-3-(hydroxymethyl)-2,8a-dimethyl-4,6,7,8-tetrahydro-3H-isoquinolin-1-one |
| SMILES | CN1C(=O)[C@@]2(C)CCCC=C2C[C@H]1CO |
| InChI | InChI=1S/C12H19NO2/c1-12-6-4-3-5-9(12)7-10(8-14)13(2)11(12)15/h5,10,14H,3-4,6-8H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | OLOPNRMYCLIUBY-JQWIXIFHSA-N |
| XLogP | 1.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|