methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate

C11H16O4 — CID 10822415

IUPACmethyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate
SMILESCOC(=O)[C@@]1(CCC(C)=O)CCCC1=O
InChIInChI=1S/C11H16O4/c1-8(12)5-7-11(10(14)15-2)6-3-4-9(11)13/h3-7H2,1-2H3/t11-/m1/s1
InChIKeyMUKWUJLEOVQNHW-LLVKDONJSA-N
MW212.24 g/mol
LogP1.27
Rot. Bonds4

About methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate

methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate (PubChem CID 10822415) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate.

Molecular Properties

Compound Namemethyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate
PubChem CID10822415
Molecular FormulaC11H16O4
Molecular Weight212.24 g/mol
Exact Mass212.10
IUPAC Namemethyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate
SMILESCOC(=O)[C@@]1(CCC(C)=O)CCCC1=O
InChIInChI=1S/C11H16O4/c1-8(12)5-7-11(10(14)15-2)6-3-4-9(11)13/h3-7H2,1-2H3/t11-/m1/s1
InChIKeyMUKWUJLEOVQNHW-LLVKDONJSA-N
XLogP1.27
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.24
LogP ≤ 51.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate?
The IUPAC name of methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate (CID 10822415) is methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate.
What is the SMILES notation for methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate?
The canonical SMILES for methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate is COC(=O)[C@@]1(CCC(C)=O)CCCC1=O.
What is the InChIKey of methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate?
The InChIKey is MUKWUJLEOVQNHW-LLVKDONJSA-N. The full InChI is InChI=1S/C11H16O4/c1-8(12)5-7-11(10(14)15-2)6-3-4-9(11)13/h3-7H2,1-2H3/t11-/m1/s1.
What are the key properties of methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate?
methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate has a molecular weight of 212.24 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-2-oxo-1-(3-oxobutyl)cyclopentane-1-carboxylate is sourced from PubChem (CID 10822415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).