C13H24O2 — CID 10822454
5,5-dimethyl-2-[(E,3S)-3-methylhex-4-enyl]-1,3-dioxane (PubChem CID 10822454) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(E,3S)-3-methylhex-4-enyl]-1,3-dioxane.
| Compound Name | 5,5-dimethyl-2-[(E,3S)-3-methylhex-4-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 10822454 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 5,5-dimethyl-2-[(E,3S)-3-methylhex-4-enyl]-1,3-dioxane |
| SMILES | C/C=C/[C@@H](C)CCC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C13H24O2/c1-5-6-11(2)7-8-12-14-9-13(3,4)10-15-12/h5-6,11-12H,7-10H2,1-4H3/b6-5+/t11-/m1/s1 |
| InChIKey | DKMKQLYKBOMLFY-MVIFTORASA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|