C11H20N2 — CID 10822632
2-cyclohexyl-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 10822632) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-cyclohexyl-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | 2-cyclohexyl-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 10822632 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-cyclohexyl-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | NC1=NC(C2CCCCC2)CCC1 |
| InChI | InChI=1S/C11H20N2/c12-11-8-4-7-10(13-11)9-5-2-1-3-6-9/h9-10H,1-8H2,(H2,12,13) |
| InChIKey | IWONLBSAXYOQRL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |