About (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol
(1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol (PubChem CID 10822654) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol.
Molecular Properties
| Compound Name | (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol |
| PubChem CID | 10822654 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol |
| SMILES | CN1CC=CC[C@H]1C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-15-10-6-5-9-13(15)11-14(16)12-7-3-2-4-8-12/h2-8,13-14,16H,9-11H2,1H3/t13-,14+/m0/s1 |
| InChIKey | NTGXMBJLVYSWLO-UONOGXRCSA-N |
| XLogP | 2.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol?
The IUPAC name of (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol (CID 10822654) is (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol.
What is the SMILES notation for (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol?
The canonical SMILES for (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol is CN1CC=CC[C@H]1C[C@@H](O)c1ccccc1.
What is the InChIKey of (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol?
The InChIKey is NTGXMBJLVYSWLO-UONOGXRCSA-N. The full InChI is InChI=1S/C14H19NO/c1-15-10-6-5-9-13(15)11-14(16)12-7-3-2-4-8-12/h2-8,13-14,16H,9-11H2,1H3/t13-,14+/m0/s1.
What are the key properties of (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol?
(1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol has a molecular weight of 217.31 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[(2S)-1-methyl-3,6-dihydro-2H-pyridin-2-yl]-1-phenylethanol is sourced from PubChem (CID 10822654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).