C13H19NO2 — CID 10822879
(1S,4S,6S,8S,9R)-3,6-dimethyl-3-azatricyclo[6.2.2.04,9]dodecane-2,11-dione (PubChem CID 10822879) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (1S,4S,6S,8S,9R)-3,6-dimethyl-3-azatricyclo[6.2.2.04,9]dodecane-2,11-dione.
| Compound Name | (1S,4S,6S,8S,9R)-3,6-dimethyl-3-azatricyclo[6.2.2.04,9]dodecane-2,11-dione |
|---|---|
| PubChem CID | 10822879 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (1S,4S,6S,8S,9R)-3,6-dimethyl-3-azatricyclo[6.2.2.04,9]dodecane-2,11-dione |
| SMILES | C[C@H]1C[C@H]2CC(=O)[C@@H]3C[C@H]2[C@H](C1)N(C)C3=O |
| InChI | InChI=1S/C13H19NO2/c1-7-3-8-5-12(15)10-6-9(8)11(4-7)14(2)13(10)16/h7-11H,3-6H2,1-2H3/t7-,8-,9+,10-,11-/m0/s1 |
| InChIKey | OPWFBJMCPAILTJ-HHKYUTTNSA-N |
| XLogP | 1.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|