C12H21NO3 — CID 10823183
(5S,8aS)-5-[(2S)-2-hydroxypentyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 10823183) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (5S,8aS)-5-[(2S)-2-hydroxypentyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5S,8aS)-5-[(2S)-2-hydroxypentyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 10823183 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (5S,8aS)-5-[(2S)-2-hydroxypentyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CCC[C@H](O)C[C@@H]1CCC[C@H]2COC(=O)N21 |
| InChI | InChI=1S/C12H21NO3/c1-2-4-11(14)7-9-5-3-6-10-8-16-12(15)13(9)10/h9-11,14H,2-8H2,1H3/t9-,10-,11-/m0/s1 |
| InChIKey | AILMUPYVIQOTPR-DCAQKATOSA-N |
| XLogP | 1.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |