C14H19BO2 — CID 10823325
2-[(1R,2S)-1,2-dimethylcyclohexyl]-1,3,2-benzodioxaborole (PubChem CID 10823325) has the molecular formula C14H19BO2 and a molecular weight of 230.12 g/mol. Its IUPAC name is 2-[(1R,2S)-1,2-dimethylcyclohexyl]-1,3,2-benzodioxaborole.
| Compound Name | 2-[(1R,2S)-1,2-dimethylcyclohexyl]-1,3,2-benzodioxaborole |
|---|---|
| PubChem CID | 10823325 |
| Molecular Formula | C14H19BO2 |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-[(1R,2S)-1,2-dimethylcyclohexyl]-1,3,2-benzodioxaborole |
| SMILES | C[C@H]1CCCC[C@]1(C)B1Oc2ccccc2O1 |
| InChI | InChI=1S/C14H19BO2/c1-11-7-5-6-10-14(11,2)15-16-12-8-3-4-9-13(12)17-15/h3-4,8-9,11H,5-7,10H2,1-2H3/t11-,14-/m0/s1 |
| InChIKey | XYKBIERYZZYTLZ-FZMZJTMJSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|