C9H12F6 — CID 10823560
1,1,2,3,3,3-hexafluoropropylcyclohexane (PubChem CID 10823560) has the molecular formula C9H12F6 and a molecular weight of 234.18 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoropropylcyclohexane.
| Compound Name | 1,1,2,3,3,3-hexafluoropropylcyclohexane |
|---|---|
| PubChem CID | 10823560 |
| Molecular Formula | C9H12F6 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoropropylcyclohexane |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C9H12F6/c10-7(9(13,14)15)8(11,12)6-4-2-1-3-5-6/h6-7H,1-5H2 |
| InChIKey | MOSJEQUZIYTEME-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |