About 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea
1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 10823585) has the molecular formula C10H10N4OS
and a molecular weight of 234.28 g/mol. Its IUPAC name is 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea |
| PubChem CID | 10823585 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(NCc1ccccc1)Nc1nncs1 |
| InChI | InChI=1S/C10H10N4OS/c15-9(13-10-14-12-7-16-10)11-6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,11,13,14,15) |
| InChIKey | LDKVMRNOUFHOST-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea?
The IUPAC name of 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea (CID 10823585) is 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea.
What is the SMILES notation for 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea?
The canonical SMILES for 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea is O=C(NCc1ccccc1)Nc1nncs1.
What is the InChIKey of 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea?
The InChIKey is LDKVMRNOUFHOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4OS/c15-9(13-10-14-12-7-16-10)11-6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,11,13,14,15).
What are the key properties of 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea?
1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea has a molecular weight of 234.28 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(1,3,4-thiadiazol-2-yl)urea is sourced from PubChem (CID 10823585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).