C9H8F3NO3 — CID 10823626
N-(2,5-dihydroxyphenyl)-2,2,2-trifluoro-N-methylacetamide (PubChem CID 10823626) has the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. Its IUPAC name is N-(2,5-dihydroxyphenyl)-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-(2,5-dihydroxyphenyl)-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 10823626 |
| Molecular Formula | C9H8F3NO3 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | N-(2,5-dihydroxyphenyl)-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(C(=O)C(F)(F)F)c1cc(O)ccc1O |
| InChI | InChI=1S/C9H8F3NO3/c1-13(8(16)9(10,11)12)6-4-5(14)2-3-7(6)15/h2-4,14-15H,1H3 |
| InChIKey | PXAWSNZVZYRJQI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|