About 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol
2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol (PubChem CID 10823724) has the molecular formula C10H12N4OS
and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol |
| PubChem CID | 10823724 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol |
| SMILES | CSc1nnc(-c2ccncc2)n1CCO |
| InChI | InChI=1S/C10H12N4OS/c1-16-10-13-12-9(14(10)6-7-15)8-2-4-11-5-3-8/h2-5,15H,6-7H2,1H3 |
| InChIKey | BFUKEXMCRFPUKA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol?
The IUPAC name of 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol (CID 10823724) is 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol.
What is the SMILES notation for 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol?
The canonical SMILES for 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol is CSc1nnc(-c2ccncc2)n1CCO.
What is the InChIKey of 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol?
The InChIKey is BFUKEXMCRFPUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4OS/c1-16-10-13-12-9(14(10)6-7-15)8-2-4-11-5-3-8/h2-5,15H,6-7H2,1H3.
What are the key properties of 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol?
2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol has a molecular weight of 236.30 g/mol, XLogP of 1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)ethanol is sourced from PubChem (CID 10823724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).