About N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide
N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide (PubChem CID 10823903) has the molecular formula C14H13N3O
and a molecular weight of 239.28 g/mol. Its IUPAC name is N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide.
Molecular Properties
| Compound Name | N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide |
| PubChem CID | 10823903 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(Nc1cccnc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H13N3O/c18-14(16-12-5-3-8-15-10-12)17-9-7-11-4-1-2-6-13(11)17/h1-6,8,10H,7,9H2,(H,16,18) |
| InChIKey | ODXHNGJYIWHPAG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide?
The IUPAC name of N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide (CID 10823903) is N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide.
What is the SMILES notation for N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide?
The canonical SMILES for N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide is O=C(Nc1cccnc1)N1CCc2ccccc21.
What is the InChIKey of N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide?
The InChIKey is ODXHNGJYIWHPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O/c18-14(16-12-5-3-8-15-10-12)17-9-7-11-4-1-2-6-13(11)17/h1-6,8,10H,7,9H2,(H,16,18).
What are the key properties of N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide?
N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide has a molecular weight of 239.28 g/mol, XLogP of 2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-3-yl-2,3-dihydroindole-1-carboxamide is sourced from PubChem (CID 10823903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).