C11H9F2NO3 — CID 10824006
methyl (Z)-2-amino-4-(3,4-difluorophenyl)-4-oxobut-2-enoate (PubChem CID 10824006) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is methyl (Z)-2-amino-4-(3,4-difluorophenyl)-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-2-amino-4-(3,4-difluorophenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 10824006 |
| Molecular Formula | C11H9F2NO3 |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | methyl (Z)-2-amino-4-(3,4-difluorophenyl)-4-oxobut-2-enoate |
| SMILES | COC(=O)/C(N)=C/C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H9F2NO3/c1-17-11(16)9(14)5-10(15)6-2-3-7(12)8(13)4-6/h2-5H,14H2,1H3/b9-5- |
| InChIKey | DQAMBXZXCQTQTE-UITAMQMPSA-N |
| XLogP | 1.16 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|