C13H11N3O2 — CID 10824017
11-prop-2-enyl-3,9,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraene-10,12-dione (PubChem CID 10824017) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 11-prop-2-enyl-3,9,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraene-10,12-dione.
| Compound Name | 11-prop-2-enyl-3,9,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 10824017 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 11-prop-2-enyl-3,9,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraene-10,12-dione |
| SMILES | C=CCC1C(=O)Nc2cccc3ncc(n23)C1=O |
| InChI | InChI=1S/C13H11N3O2/c1-2-4-8-12(17)9-7-14-10-5-3-6-11(16(9)10)15-13(8)18/h2-3,5-8H,1,4H2,(H,15,18) |
| InChIKey | SOOHPAAWAPJTMU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|