C13H28N2S — CID 10824235
N-tert-butyl-2-(butylamino)-3-methylbutanethioamide (PubChem CID 10824235) has the molecular formula C13H28N2S and a molecular weight of 244.45 g/mol. Its IUPAC name is N-tert-butyl-2-(butylamino)-3-methylbutanethioamide.
| Compound Name | N-tert-butyl-2-(butylamino)-3-methylbutanethioamide |
|---|---|
| PubChem CID | 10824235 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | N-tert-butyl-2-(butylamino)-3-methylbutanethioamide |
| SMILES | CCCCNC(C(=S)NC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H28N2S/c1-7-8-9-14-11(10(2)3)12(16)15-13(4,5)6/h10-11,14H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | OCNJOELMCKSDCI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|